C14H19N4+ — CID 2178
View drug profile → amprolium5-[(2-methylpyridin-1-ium-1-yl)methyl]-2-propylpyrimidin-4-amine (PubChem CID 2178) has the molecular formula C14H19N4+ and a molecular weight of 243.33 g/mol. Its IUPAC name is 5-[(2-methylpyridin-1-ium-1-yl)methyl]-2-propylpyrimidin-4-amine.
| Compound Name | 5-[(2-methylpyridin-1-ium-1-yl)methyl]-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 2178 |
| Molecular Formula | C14H19N4+ |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 5-[(2-methylpyridin-1-ium-1-yl)methyl]-2-propylpyrimidin-4-amine |
| SMILES | CCCc1ncc(C[n+]2ccccc2C)c(N)n1 |
| InChI | InChI=1S/C14H19N4/c1-3-6-13-16-9-12(14(15)17-13)10-18-8-5-4-7-11(18)2/h4-5,7-9H,3,6,10H2,1-2H3,(H2,15,16,17)/q+1 |
| InChIKey | IPZFPROOBOUEIG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|