C18H29NO3 — CID 8645
View drug profile → amprotropine[3-(diethylamino)-2,2-dimethylpropyl] 3-hydroxy-2-phenylpropanoate (PubChem CID 8645) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is [3-(diethylamino)-2,2-dimethylpropyl] 3-hydroxy-2-phenylpropanoate.
| Compound Name | [3-(diethylamino)-2,2-dimethylpropyl] 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 8645 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | [3-(diethylamino)-2,2-dimethylpropyl] 3-hydroxy-2-phenylpropanoate |
| SMILES | CCN(CC)CC(C)(C)COC(=O)C(CO)c1ccccc1 |
| InChI | InChI=1S/C18H29NO3/c1-5-19(6-2)13-18(3,4)14-22-17(21)16(12-20)15-10-8-7-9-11-15/h7-11,16,20H,5-6,12-14H2,1-4H3 |
| InChIKey | ORXLOAFNULMXBG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |