About 4-hexylbenzene-1,3-diol
4-hexylbenzene-1,3-diol (PubChem CID 3610) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-hexylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 4-hexylbenzene-1,3-diol |
| PubChem CID | 3610 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-hexylbenzene-1,3-diol |
| SMILES | CCCCCCc1ccc(O)cc1O |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h7-9,13-14H,2-6H2,1H3 |
| InChIKey | WFJIVOKAWHGMBH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexylbenzene-1,3-diol?
The IUPAC name of 4-hexylbenzene-1,3-diol (CID 3610) is 4-hexylbenzene-1,3-diol.
What is the SMILES notation for 4-hexylbenzene-1,3-diol?
The canonical SMILES for 4-hexylbenzene-1,3-diol is CCCCCCc1ccc(O)cc1O.
What is the InChIKey of 4-hexylbenzene-1,3-diol?
The InChIKey is WFJIVOKAWHGMBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h7-9,13-14H,2-6H2,1H3.
What are the key properties of 4-hexylbenzene-1,3-diol?
4-hexylbenzene-1,3-diol has a molecular weight of 194.27 g/mol, XLogP of 3.22, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexylbenzene-1,3-diol is sourced from PubChem (CID 3610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).