C17H18N2O5S — CID 4849
View drug profile → piretanide4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid (PubChem CID 4849) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid.
| Compound Name | 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 4849 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(N2CCCC2)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H18N2O5S/c18-25(22,23)15-11-12(17(20)21)10-14(19-8-4-5-9-19)16(15)24-13-6-2-1-3-7-13/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,21)(H2,18,22,23) |
| InChIKey | UJEWTUDSLQGTOA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |