benzoic acid

C7H6O2 — CID 243

💊View drug profile → benzoic acid
IUPACbenzoic acid
SMILESO=C(O)c1ccccc1
InChIInChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)
InChIKeyWPYMKLBDIGXBTP-UHFFFAOYSA-N
MW122.12 g/mol
LogP1.38
Rot. Bonds1

About benzoic acid

benzoic acid (PubChem CID 243) has the molecular formula C7H6O2 and a molecular weight of 122.12 g/mol. Its IUPAC name is benzoic acid.

Molecular Properties

Compound Namebenzoic acid
PubChem CID243
Molecular FormulaC7H6O2
Molecular Weight122.12 g/mol
Exact Mass122.04
IUPAC Namebenzoic acid
SMILESO=C(O)c1ccccc1
InChIInChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)
InChIKeyWPYMKLBDIGXBTP-UHFFFAOYSA-N
XLogP1.38
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500122.12
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzoic acid?
The IUPAC name of benzoic acid (CID 243) is benzoic acid.
What is the SMILES notation for benzoic acid?
The canonical SMILES for benzoic acid is O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid?
The InChIKey is WPYMKLBDIGXBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9).
What are the key properties of benzoic acid?
benzoic acid has a molecular weight of 122.12 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid is sourced from PubChem (CID 243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).