C6HBiBr4O3 — CID 10100751
View drug profile → bibrocatholbismuth;3,4,5,6-tetrabromobenzene-1,2-diolate;hydroxide (PubChem CID 10100751) has the molecular formula C6HBiBr4O3 and a molecular weight of 649.67 g/mol. Its IUPAC name is bismuth;3,4,5,6-tetrabromobenzene-1,2-diolate;hydroxide.
| Compound Name | bismuth;3,4,5,6-tetrabromobenzene-1,2-diolate;hydroxide |
|---|---|
| PubChem CID | 10100751 |
| Molecular Formula | C6HBiBr4O3 |
| Molecular Weight | 649.67 g/mol |
| Exact Mass | 645.65 |
| IUPAC Name | bismuth;3,4,5,6-tetrabromobenzene-1,2-diolate;hydroxide |
| SMILES | [Bi+3].[O-]c1c([O-])c(Br)c(Br)c(Br)c1Br.[OH-] |
| InChI | InChI=1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3 |
| InChIKey | VTAVFIZOZUAKKE-UHFFFAOYSA-K |
| XLogP | 2.33 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.67 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|