C18H26N2O4 — CID 4922
View drug profile → proglumide4-benzamido-5-(dipropylamino)-5-oxopentanoic acid (PubChem CID 4922) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-benzamido-5-(dipropylamino)-5-oxopentanoic acid.
| Compound Name | 4-benzamido-5-(dipropylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 4922 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-benzamido-5-(dipropylamino)-5-oxopentanoic acid |
| SMILES | CCCN(CCC)C(=O)C(CCC(=O)O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-12-20(13-4-2)18(24)15(10-11-16(21)22)19-17(23)14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | DGMKFQYCZXERLX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |