About 2-amino-1-phenylethanol
2-amino-1-phenylethanol (PubChem CID 1000) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-amino-1-phenylethanol.
Molecular Properties
| Compound Name | 2-amino-1-phenylethanol |
| PubChem CID | 1000 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-amino-1-phenylethanol |
| SMILES | NCC(O)c1ccccc1 |
| InChI | InChI=1S/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2 |
| InChIKey | ULSIYEODSMZIPX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-phenylethanol?
The IUPAC name of 2-amino-1-phenylethanol (CID 1000) is 2-amino-1-phenylethanol.
What is the SMILES notation for 2-amino-1-phenylethanol?
The canonical SMILES for 2-amino-1-phenylethanol is NCC(O)c1ccccc1.
What is the InChIKey of 2-amino-1-phenylethanol?
The InChIKey is ULSIYEODSMZIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2.
What are the key properties of 2-amino-1-phenylethanol?
2-amino-1-phenylethanol has a molecular weight of 137.18 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-phenylethanol is sourced from PubChem (CID 1000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).