C17H19NS2 — CID 6537425
View drug profile → bisulepine(3Z)-N,N-dimethyl-3-(5H-thieno[2,3-c][2]benzothiepin-10-ylidene)propan-1-amine (PubChem CID 6537425) has the molecular formula C17H19NS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is (3Z)-N,N-dimethyl-3-(5H-thieno[2,3-c][2]benzothiepin-10-ylidene)propan-1-amine.
| Compound Name | (3Z)-N,N-dimethyl-3-(5H-thieno[2,3-c][2]benzothiepin-10-ylidene)propan-1-amine |
|---|---|
| PubChem CID | 6537425 |
| Molecular Formula | C17H19NS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (3Z)-N,N-dimethyl-3-(5H-thieno[2,3-c][2]benzothiepin-10-ylidene)propan-1-amine |
| SMILES | CN(C)CC/C=C1/c2ccccc2CSc2sccc21 |
| InChI | InChI=1S/C17H19NS2/c1-18(2)10-5-8-15-14-7-4-3-6-13(14)12-20-17-16(15)9-11-19-17/h3-4,6-9,11H,5,10,12H2,1-2H3/b15-8- |
| InChIKey | ZLJLUTCIUOCIQM-NVNXTCNLSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_C(4)', 'substructure': 'N/A'} |
|---|