C15H16I3NO3 — CID 6436657
View drug profile → bunamiodyl(2E)-2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methylidene]butanoic acid (PubChem CID 6436657) has the molecular formula C15H16I3NO3 and a molecular weight of 639.01 g/mol. Its IUPAC name is (2E)-2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methylidene]butanoic acid.
| Compound Name | (2E)-2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 6436657 |
| Molecular Formula | C15H16I3NO3 |
| Molecular Weight | 639.01 g/mol |
| Exact Mass | 638.83 |
| IUPAC Name | (2E)-2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methylidene]butanoic acid |
| SMILES | CCCC(=O)Nc1c(I)cc(I)c(/C=C(\CC)C(=O)O)c1I |
| InChI | InChI=1S/C15H16I3NO3/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22/h6-7H,3-5H2,1-2H3,(H,19,20)(H,21,22)/b8-6+ |
| InChIKey | CWRBDUIQDIHWJZ-SOFGYWHQSA-N |
| XLogP | 5.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.01 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|