About 2-(diethylamino)ethyl 2-phenylbutanoate
2-(diethylamino)ethyl 2-phenylbutanoate (PubChem CID 27368) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-phenylbutanoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-phenylbutanoate |
| PubChem CID | 27368 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-(diethylamino)ethyl 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCCN(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C16H25NO2/c1-4-15(14-10-8-7-9-11-14)16(18)19-13-12-17(5-2)6-3/h7-11,15H,4-6,12-13H2,1-3H3 |
| InChIKey | CKWHSYRZDLWQFV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-phenylbutanoate?
The IUPAC name of 2-(diethylamino)ethyl 2-phenylbutanoate (CID 27368) is 2-(diethylamino)ethyl 2-phenylbutanoate.
What is the SMILES notation for 2-(diethylamino)ethyl 2-phenylbutanoate?
The canonical SMILES for 2-(diethylamino)ethyl 2-phenylbutanoate is CCC(C(=O)OCCN(CC)CC)c1ccccc1.
What is the InChIKey of 2-(diethylamino)ethyl 2-phenylbutanoate?
The InChIKey is CKWHSYRZDLWQFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-4-15(14-10-8-7-9-11-14)16(18)19-13-12-17(5-2)6-3/h7-11,15H,4-6,12-13H2,1-3H3.
What are the key properties of 2-(diethylamino)ethyl 2-phenylbutanoate?
2-(diethylamino)ethyl 2-phenylbutanoate has a molecular weight of 263.38 g/mol, XLogP of 3.07, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-phenylbutanoate is sourced from PubChem (CID 27368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).