About 5,7-dichloroquinolin-8-ol
5,7-dichloroquinolin-8-ol (PubChem CID 2722) has the molecular formula C9H5Cl2NO
and a molecular weight of 214.05 g/mol. Its IUPAC name is 5,7-dichloroquinolin-8-ol.
Molecular Properties
| Compound Name | 5,7-dichloroquinolin-8-ol |
| PubChem CID | 2722 |
| Molecular Formula | C9H5Cl2NO |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 5,7-dichloroquinolin-8-ol |
| SMILES | Oc1c(Cl)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C9H5Cl2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | WDFKMLRRRCGAKS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dichloroquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloroquinolin-8-ol?
The IUPAC name of 5,7-dichloroquinolin-8-ol (CID 2722) is 5,7-dichloroquinolin-8-ol.
What is the SMILES notation for 5,7-dichloroquinolin-8-ol?
The canonical SMILES for 5,7-dichloroquinolin-8-ol is Oc1c(Cl)cc(Cl)c2cccnc12.
What is the InChIKey of 5,7-dichloroquinolin-8-ol?
The InChIKey is WDFKMLRRRCGAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H.
What are the key properties of 5,7-dichloroquinolin-8-ol?
5,7-dichloroquinolin-8-ol has a molecular weight of 214.05 g/mol, XLogP of 3.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloroquinolin-8-ol is sourced from PubChem (CID 2722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).