About 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate
2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate (PubChem CID 17036) has the molecular formula C20H25NO3
and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate |
| PubChem CID | 17036 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate |
| SMILES | CCOC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO3/c1-4-24-20(17-11-7-5-8-12-17,18-13-9-6-10-14-18)19(22)23-16-15-21(2)3/h5-14H,4,15-16H2,1-3H3 |
| InChIKey | RHUWRJWFHUKVED-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate?
The IUPAC name of 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate (CID 17036) is 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate is CCOC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate?
The InChIKey is RHUWRJWFHUKVED-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3/c1-4-24-20(17-11-7-5-8-12-17,18-13-9-6-10-14-18)19(22)23-16-15-21(2)3/h5-14H,4,15-16H2,1-3H3.
What are the key properties of 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate?
2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate has a molecular weight of 327.42 g/mol, XLogP of 3.07, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-ethoxy-2,2-diphenylacetate is sourced from PubChem (CID 17036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).