C10H20O3 — CID 10105
View drug profile → promoxolane[2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 10105) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is [2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10105 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | [2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CC(C)C1(C(C)C)OCC(CO)O1 |
| InChI | InChI=1S/C10H20O3/c1-7(2)10(8(3)4)12-6-9(5-11)13-10/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | HHFOOWPWAXNJNY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |