C8H13NO3 — CID 12798
View drug profile → diethadione5,5-diethyl-1,3-oxazinane-2,4-dione (PubChem CID 12798) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 5,5-diethyl-1,3-oxazinane-2,4-dione.
| Compound Name | 5,5-diethyl-1,3-oxazinane-2,4-dione |
|---|---|
| PubChem CID | 12798 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 5,5-diethyl-1,3-oxazinane-2,4-dione |
| SMILES | CCC1(CC)COC(=O)NC1=O |
| InChI | InChI=1S/C8H13NO3/c1-3-8(4-2)5-12-7(11)9-6(8)10/h3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | ORTYMGHCFWKXHO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |