C9H11Cl2N3O4S2 — CID 4121
View drug profile → methylclothiazide6-chloro-3-(chloromethyl)-2-methyl-1,1-dioxo-3,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 4121) has the molecular formula C9H11Cl2N3O4S2 and a molecular weight of 360.24 g/mol. Its IUPAC name is 6-chloro-3-(chloromethyl)-2-methyl-1,1-dioxo-3,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-3-(chloromethyl)-2-methyl-1,1-dioxo-3,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 4121 |
| Molecular Formula | C9H11Cl2N3O4S2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 6-chloro-3-(chloromethyl)-2-methyl-1,1-dioxo-3,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | CN1C(CCl)Nc2cc(Cl)c(S(N)(=O)=O)cc2S1(=O)=O |
| InChI | InChI=1S/C9H11Cl2N3O4S2/c1-14-9(4-10)13-6-2-5(11)7(19(12,15)16)3-8(6)20(14,17)18/h2-3,9,13H,4H2,1H3,(H2,12,15,16) |
| InChIKey | CESYKOGBSMNBPD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|