C15H15N3O — CID 2017
View drug profile → ethacridine7-ethoxyacridine-3,9-diamine (PubChem CID 2017) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 7-ethoxyacridine-3,9-diamine.
| Compound Name | 7-ethoxyacridine-3,9-diamine |
|---|---|
| PubChem CID | 2017 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 7-ethoxyacridine-3,9-diamine |
| SMILES | CCOc1ccc2nc3cc(N)ccc3c(N)c2c1 |
| InChI | InChI=1S/C15H15N3O/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13/h3-8H,2,16H2,1H3,(H2,17,18) |
| InChIKey | CIKWKGFPFXJVGW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|