About (4R)-4-amino-1,2-oxazolidin-3-one
(4R)-4-amino-1,2-oxazolidin-3-one (PubChem CID 6234) has the molecular formula C3H6N2O2
and a molecular weight of 102.09 g/mol. Its IUPAC name is (4R)-4-amino-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | (4R)-4-amino-1,2-oxazolidin-3-one |
| PubChem CID | 6234 |
| Molecular Formula | C3H6N2O2 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | (4R)-4-amino-1,2-oxazolidin-3-one |
| SMILES | N[C@@H]1CONC1=O |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m1/s1 |
| InChIKey | DYDCUQKUCUHJBH-UWTATZPHSA-N |
| XLogP | -1.62 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-amino-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-amino-1,2-oxazolidin-3-one?
The IUPAC name of (4R)-4-amino-1,2-oxazolidin-3-one (CID 6234) is (4R)-4-amino-1,2-oxazolidin-3-one.
What is the SMILES notation for (4R)-4-amino-1,2-oxazolidin-3-one?
The canonical SMILES for (4R)-4-amino-1,2-oxazolidin-3-one is N[C@@H]1CONC1=O.
What is the InChIKey of (4R)-4-amino-1,2-oxazolidin-3-one?
The InChIKey is DYDCUQKUCUHJBH-UWTATZPHSA-N. The full InChI is InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m1/s1.
What are the key properties of (4R)-4-amino-1,2-oxazolidin-3-one?
(4R)-4-amino-1,2-oxazolidin-3-one has a molecular weight of 102.09 g/mol, XLogP of -1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-1,2-oxazolidin-3-one is sourced from PubChem (CID 6234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).