C8H6N2O2 — CID 13883
View drug profile → fenadiazole2-(1,3,4-oxadiazol-2-yl)phenol (PubChem CID 13883) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is 2-(1,3,4-oxadiazol-2-yl)phenol.
| Compound Name | 2-(1,3,4-oxadiazol-2-yl)phenol |
|---|---|
| PubChem CID | 13883 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2-(1,3,4-oxadiazol-2-yl)phenol |
| SMILES | Oc1ccccc1-c1nnco1 |
| InChI | InChI=1S/C8H6N2O2/c11-7-4-2-1-3-6(7)8-10-9-5-12-8/h1-5,11H |
| InChIKey | OINXXHYENYVYPB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |