C4H3FN2O2 — CID 3385
View drug profile → fluorouracil5-fluoro-1H-pyrimidine-2,4-dione (PubChem CID 3385) has the molecular formula C4H3FN2O2 and a molecular weight of 130.08 g/mol. Its IUPAC name is 5-fluoro-1H-pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3385 |
| Molecular Formula | C4H3FN2O2 |
| Molecular Weight | 130.08 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 5-fluoro-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | GHASVSINZRGABV-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.08 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |