C13H21O5P — CID 3038498
View drug profile → fospropofol[2,6-di(propan-2-yl)phenoxy]methyl dihydrogen phosphate (PubChem CID 3038498) has the molecular formula C13H21O5P and a molecular weight of 288.28 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenoxy]methyl dihydrogen phosphate.
| Compound Name | [2,6-di(propan-2-yl)phenoxy]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 3038498 |
| Molecular Formula | C13H21O5P |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [2,6-di(propan-2-yl)phenoxy]methyl dihydrogen phosphate |
| SMILES | CC(C)c1cccc(C(C)C)c1OCOP(=O)(O)O |
| InChI | InChI=1S/C13H21O5P/c1-9(2)11-6-5-7-12(10(3)4)13(11)17-8-18-19(14,15)16/h5-7,9-10H,8H2,1-4H3,(H2,14,15,16) |
| InChIKey | QVNNONOFASOXQV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|