C24H42N2 — CID 3030835
View drug profile → feclemine2-[cyclohexyl(phenyl)methyl]-N,N,N',N'-tetraethylpropane-1,3-diamine (PubChem CID 3030835) has the molecular formula C24H42N2 and a molecular weight of 358.61 g/mol. Its IUPAC name is 2-[cyclohexyl(phenyl)methyl]-N,N,N',N'-tetraethylpropane-1,3-diamine.
| Compound Name | 2-[cyclohexyl(phenyl)methyl]-N,N,N',N'-tetraethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 3030835 |
| Molecular Formula | C24H42N2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.33 |
| IUPAC Name | 2-[cyclohexyl(phenyl)methyl]-N,N,N',N'-tetraethylpropane-1,3-diamine |
| SMILES | CCN(CC)CC(CN(CC)CC)C(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H42N2/c1-5-25(6-2)19-23(20-26(7-3)8-4)24(21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9,11-12,15-16,22-24H,5-8,10,13-14,17-20H2,1-4H3 |
| InChIKey | QDMORDTWFMWOFA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |