C19H17ClN2O4 — CID 3474
View drug profile → glafenine2,3-dihydroxypropyl 2-[(7-chloroquinolin-4-yl)amino]benzoate (PubChem CID 3474) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-[(7-chloroquinolin-4-yl)amino]benzoate.
| Compound Name | 2,3-dihydroxypropyl 2-[(7-chloroquinolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 3474 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2,3-dihydroxypropyl 2-[(7-chloroquinolin-4-yl)amino]benzoate |
| SMILES | O=C(OCC(O)CO)c1ccccc1Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22) |
| InChIKey | GWOFUCIGLDBNKM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |