About gold dinitrate
gold dinitrate (PubChem CID 161234525) has the molecular formula AuN2O6-2
and a molecular weight of 320.98 g/mol. Its IUPAC name is gold dinitrate.
Molecular Properties
| Compound Name | gold dinitrate |
| PubChem CID | 161234525 |
| Molecular Formula | AuN2O6-2 |
| Molecular Weight | 320.98 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | gold dinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Au] |
| InChI | InChI=1S/Au.2NO3/c;2*2-1(3)4/q;2*-1 |
| InChIKey | HCYLARRXFPFDHM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 132.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.98 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze gold dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold dinitrate?
The IUPAC name of gold dinitrate (CID 161234525) is gold dinitrate.
What is the SMILES notation for gold dinitrate?
The canonical SMILES for gold dinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Au].
What is the InChIKey of gold dinitrate?
The InChIKey is HCYLARRXFPFDHM-UHFFFAOYSA-N. The full InChI is InChI=1S/Au.2NO3/c;2*2-1(3)4/q;2*-1.
What are the key properties of gold dinitrate?
gold dinitrate has a molecular weight of 320.98 g/mol, XLogP of -0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for gold dinitrate is sourced from PubChem (CID 161234525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).