C19H21ClN2OS — CID 17457
View drug profile → haletazole2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]-N,N-diethylethanamine (PubChem CID 17457) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 17457 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[4-(5-chloro-1,3-benzothiazol-2-yl)phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(-c2nc3cc(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-3-22(4-2)11-12-23-16-8-5-14(6-9-16)19-21-17-13-15(20)7-10-18(17)24-19/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | TXOKWXJQVFUUDD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |