C9H4Cl3IO — CID 3561
View drug profile → haloprogin1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)benzene (PubChem CID 3561) has the molecular formula C9H4Cl3IO and a molecular weight of 361.39 g/mol. Its IUPAC name is 1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)benzene.
| Compound Name | 1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)benzene |
|---|---|
| PubChem CID | 3561 |
| Molecular Formula | C9H4Cl3IO |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 359.84 |
| IUPAC Name | 1,2,4-trichloro-5-(3-iodoprop-2-ynoxy)benzene |
| SMILES | Clc1cc(Cl)c(OCC#CI)cc1Cl |
| InChI | InChI=1S/C9H4Cl3IO/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H,3H2 |
| InChIKey | CTETYYAZBPJBHE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|