C6H12N4 — CID 4101
View drug profile → methenamine1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (PubChem CID 4101) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane.
| Compound Name | 1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 4101 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
| SMILES | C1N2CN3CN1CN(C2)C3 |
| InChI | InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2 |
| InChIKey | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |