About indolizine
indolizine (PubChem CID 9230) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is indolizine.
Molecular Properties
| Compound Name | indolizine |
| PubChem CID | 9230 |
| Molecular Formula | C8H7N |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | indolizine |
| SMILES | c1ccn2cccc2c1 |
| InChI | InChI=1S/C8H7N/c1-2-6-9-7-3-5-8(9)4-1/h1-7H |
| InChIKey | HOBCFUWDNJPFHB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizine?
The IUPAC name of indolizine (CID 9230) is indolizine.
What is the SMILES notation for indolizine?
The canonical SMILES for indolizine is c1ccn2cccc2c1.
What is the InChIKey of indolizine?
The InChIKey is HOBCFUWDNJPFHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N/c1-2-6-9-7-3-5-8(9)4-1/h1-7H.
What are the key properties of indolizine?
indolizine has a molecular weight of 117.15 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indolizine is sourced from PubChem (CID 9230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).