C17H17N3O — CID 135418340
View drug profile → ramosetron(1-methylindol-3-yl)-[(5R)-4,5,6,7-tetrahydro-1H-benzimidazol-5-yl]methanone (PubChem CID 135418340) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is (1-methylindol-3-yl)-[(5R)-4,5,6,7-tetrahydro-1H-benzimidazol-5-yl]methanone.
| Compound Name | (1-methylindol-3-yl)-[(5R)-4,5,6,7-tetrahydro-1H-benzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 135418340 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (1-methylindol-3-yl)-[(5R)-4,5,6,7-tetrahydro-1H-benzimidazol-5-yl]methanone |
| SMILES | Cn1cc(C(=O)[C@@H]2CCc3[nH]cnc3C2)c2ccccc21 |
| InChI | InChI=1S/C17H17N3O/c1-20-9-13(12-4-2-3-5-16(12)20)17(21)11-6-7-14-15(8-11)19-10-18-14/h2-5,9-11H,6-8H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | NTHPAPBPFQJABD-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |