C17H22N2 — CID 13751
View drug profile → phenbenzamineN'-benzyl-N,N-dimethyl-N'-phenylethane-1,2-diamine (PubChem CID 13751) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N'-benzyl-N,N-dimethyl-N'-phenylethane-1,2-diamine.
| Compound Name | N'-benzyl-N,N-dimethyl-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 13751 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N'-benzyl-N,N-dimethyl-N'-phenylethane-1,2-diamine |
| SMILES | CN(C)CCN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2/c1-18(2)13-14-19(17-11-7-4-8-12-17)15-16-9-5-3-6-10-16/h3-12H,13-15H2,1-2H3 |
| InChIKey | CHOBRHHOYQKCOU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |