C11H12N2S — CID 26879
View drug profile → levamisole(6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 26879) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 26879 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | c1ccc([C@H]2CN3CCSC3=N2)cc1 |
| InChI | InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
| InChIKey | HLFSDGLLUJUHTE-SNVBAGLBSA-N |
| XLogP | 2.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |