C16H13ClN2O — CID 4020
View drug profile → mazindol5-(4-chlorophenyl)-2,3-dihydroimidazo[1,2-b]isoindol-5-ol (PubChem CID 4020) has the molecular formula C16H13ClN2O and a molecular weight of 284.75 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3-dihydroimidazo[1,2-b]isoindol-5-ol.
| Compound Name | 5-(4-chlorophenyl)-2,3-dihydroimidazo[1,2-b]isoindol-5-ol |
|---|---|
| PubChem CID | 4020 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-dihydroimidazo[1,2-b]isoindol-5-ol |
| SMILES | OC1(c2ccc(Cl)cc2)c2ccccc2C2=NCCN21 |
| InChI | InChI=1S/C16H13ClN2O/c17-12-7-5-11(6-8-12)16(20)14-4-2-1-3-13(14)15-18-9-10-19(15)16/h1-8,20H,9-10H2 |
| InChIKey | ZPXSCAKFGYXMGA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |