C12H15AsN6OS2 — CID 10311
View drug profile → melarsoprol[2-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]-1,3,2-dithiarsolan-4-yl]methanol (PubChem CID 10311) has the molecular formula C12H15AsN6OS2 and a molecular weight of 398.35 g/mol. Its IUPAC name is [2-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]-1,3,2-dithiarsolan-4-yl]methanol.
| Compound Name | [2-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]-1,3,2-dithiarsolan-4-yl]methanol |
|---|---|
| PubChem CID | 10311 |
| Molecular Formula | C12H15AsN6OS2 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | [2-[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]-1,3,2-dithiarsolan-4-yl]methanol |
| SMILES | Nc1nc(N)nc(Nc2ccc([As]3SCC(CO)S3)cc2)n1 |
| InChI | InChI=1S/C12H15AsN6OS2/c14-10-17-11(15)19-12(18-10)16-8-3-1-7(2-4-8)13-21-6-9(5-20)22-13/h1-4,9,20H,5-6H2,(H5,14,15,16,17,18,19) |
| InChIKey | JCYZMTMYPZHVBF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|