C8H13NO2 — CID 2310
View drug profile → bemegride4-ethyl-4-methylpiperidine-2,6-dione (PubChem CID 2310) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-ethyl-4-methylpiperidine-2,6-dione.
| Compound Name | 4-ethyl-4-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 2310 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-ethyl-4-methylpiperidine-2,6-dione |
| SMILES | CCC1(C)CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | ORRZGUBHBVWWOP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|