C19H18N6O6 — CID 9507
1,3-bis(4-nitrophenyl)urea;4,6-dimethyl-1H-pyrimidin-2-one (PubChem CID 9507) has the molecular formula C19H18N6O6 and a molecular weight of 426.39 g/mol. Its IUPAC name is 1,3-bis(4-nitrophenyl)urea;4,6-dimethyl-1H-pyrimidin-2-one.
| Compound Name | 1,3-bis(4-nitrophenyl)urea;4,6-dimethyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 9507 |
| Molecular Formula | C19H18N6O6 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1,3-bis(4-nitrophenyl)urea;4,6-dimethyl-1H-pyrimidin-2-one |
| SMILES | Cc1cc(C)[nH]c(=O)n1.O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H10N4O5.C6H8N2O/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22;1-4-3-5(2)8-6(9)7-4/h1-8H,(H2,14,15,18);3H,1-2H3,(H,7,8,9) |
| InChIKey | UKHWDRMMMYWSFL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 173.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|