About 2-(dimethylamino)ethanol
2-(dimethylamino)ethanol (PubChem CID 7902) has the molecular formula C4H11NO
and a molecular weight of 89.14 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethanol |
| PubChem CID | 7902 |
| Molecular Formula | C4H11NO |
| Molecular Weight | 89.14 g/mol |
| Exact Mass | 89.08 |
| IUPAC Name | 2-(dimethylamino)ethanol |
| SMILES | CN(C)CCO |
| InChI | InChI=1S/C4H11NO/c1-5(2)3-4-6/h6H,3-4H2,1-2H3 |
| InChIKey | UEEJHVSXFDXPFK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dimethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethanol?
The IUPAC name of 2-(dimethylamino)ethanol (CID 7902) is 2-(dimethylamino)ethanol.
What is the SMILES notation for 2-(dimethylamino)ethanol?
The canonical SMILES for 2-(dimethylamino)ethanol is CN(C)CCO.
What is the InChIKey of 2-(dimethylamino)ethanol?
The InChIKey is UEEJHVSXFDXPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO/c1-5(2)3-4-6/h6H,3-4H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethanol?
2-(dimethylamino)ethanol has a molecular weight of 89.14 g/mol, XLogP of -0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanol is sourced from PubChem (CID 7902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).