C16H13NO4 — CID 5459346
View drug profile → papaveroline1-[(3,4-dihydroxyphenyl)methyl]isoquinoline-6,7-diol (PubChem CID 5459346) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-[(3,4-dihydroxyphenyl)methyl]isoquinoline-6,7-diol.
| Compound Name | 1-[(3,4-dihydroxyphenyl)methyl]isoquinoline-6,7-diol |
|---|---|
| PubChem CID | 5459346 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-[(3,4-dihydroxyphenyl)methyl]isoquinoline-6,7-diol |
| SMILES | Oc1ccc(Cc2nccc3cc(O)c(O)cc23)cc1O |
| InChI | InChI=1S/C16H13NO4/c18-13-2-1-9(6-14(13)19)5-12-11-8-16(21)15(20)7-10(11)3-4-17-12/h1-4,6-8,18-21H,5H2 |
| InChIKey | MXQKCNCLQIHHJA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|