C7H11NO3 — CID 8280
View drug profile → paramethadione5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione (PubChem CID 8280) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 8280 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione |
| SMILES | CCC1(C)OC(=O)N(C)C1=O |
| InChI | InChI=1S/C7H11NO3/c1-4-7(2)5(9)8(3)6(10)11-7/h4H2,1-3H3 |
| InChIKey | VQASKUSHBVDKGU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |