C18H30NO3S+ — CID 6067
View drug profile → penthienate2-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)oxyethyl-diethyl-methylazanium (PubChem CID 6067) has the molecular formula C18H30NO3S+ and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)oxyethyl-diethyl-methylazanium.
| Compound Name | 2-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)oxyethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 6067 |
| Molecular Formula | C18H30NO3S+ |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-(2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetyl)oxyethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCOC(=O)C(O)(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C18H30NO3S/c1-4-19(3,5-2)12-13-22-17(20)18(21,15-9-6-7-10-15)16-11-8-14-23-16/h8,11,14-15,21H,4-7,9-10,12-13H2,1-3H3/q+1 |
| InChIKey | NEMLPWNINZELKP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|