C13H12N2O3 — CID 8274
View drug profile → phenallymal5-phenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 8274) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-phenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-phenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 8274 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-phenyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(c2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C13H12N2O3/c1-2-8-13(9-6-4-3-5-7-9)10(16)14-12(18)15-11(13)17/h2-7H,1,8H2,(H2,14,15,16,17,18) |
| InChIKey | WOIGZSBYKGQJGL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|