C19H19N — CID 11291
View drug profile → phenindamine2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 11291) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | 2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 11291 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | CN1CCC2=C(C1)C(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C19H19N/c1-20-12-11-16-15-9-5-6-10-17(15)19(18(16)13-20)14-7-3-2-4-8-14/h2-10,19H,11-13H2,1H3 |
| InChIKey | ISFHAYSTHMVOJR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |