C10H11I2NO3 — CID 4949
View drug profile → propyliodonepropyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate (PubChem CID 4949) has the molecular formula C10H11I2NO3 and a molecular weight of 447.01 g/mol. Its IUPAC name is propyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate.
| Compound Name | propyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 4949 |
| Molecular Formula | C10H11I2NO3 |
| Molecular Weight | 447.01 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | propyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate |
| SMILES | CCCOC(=O)Cn1cc(I)c(=O)c(I)c1 |
| InChI | InChI=1S/C10H11I2NO3/c1-2-3-16-9(14)6-13-4-7(11)10(15)8(12)5-13/h4-5H,2-3,6H2,1H3 |
| InChIKey | ROSXARVHJNYYDO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.01 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|