C10H12ClN3O3S — CID 6307
View drug profile → quinethazone7-chloro-2-ethyl-4-oxo-2,3-dihydro-1H-quinazoline-6-sulfonamide (PubChem CID 6307) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is 7-chloro-2-ethyl-4-oxo-2,3-dihydro-1H-quinazoline-6-sulfonamide.
| Compound Name | 7-chloro-2-ethyl-4-oxo-2,3-dihydro-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 6307 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 7-chloro-2-ethyl-4-oxo-2,3-dihydro-1H-quinazoline-6-sulfonamide |
| SMILES | CCC1NC(=O)c2cc(S(N)(=O)=O)c(Cl)cc2N1 |
| InChI | InChI=1S/C10H12ClN3O3S/c1-2-9-13-7-4-6(11)8(18(12,16)17)3-5(7)10(15)14-9/h3-4,9,13H,2H2,1H3,(H,14,15)(H2,12,16,17) |
| InChIKey | AGMMTXLNIQSRCG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |