C13H17N5O2S — CID 16132
View drug profile → sulfasymazine4-amino-N-(4,6-diethyl-1,3,5-triazin-2-yl)benzenesulfonamide (PubChem CID 16132) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-amino-N-(4,6-diethyl-1,3,5-triazin-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(4,6-diethyl-1,3,5-triazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 16132 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-amino-N-(4,6-diethyl-1,3,5-triazin-2-yl)benzenesulfonamide |
| SMILES | CCc1nc(CC)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C13H17N5O2S/c1-3-11-15-12(4-2)17-13(16-11)18-21(19,20)10-7-5-9(14)6-8-10/h5-8H,3-4,14H2,1-2H3,(H,15,16,17,18) |
| InChIKey | ZQMQGBHQZZQTJE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|