C8H9FN2O3 — CID 5386
View drug profile → tegafur5-fluoro-1-(oxolan-2-yl)pyrimidine-2,4-dione (PubChem CID 5386) has the molecular formula C8H9FN2O3 and a molecular weight of 200.17 g/mol. Its IUPAC name is 5-fluoro-1-(oxolan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(oxolan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5386 |
| Molecular Formula | C8H9FN2O3 |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5-fluoro-1-(oxolan-2-yl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CCCO2)cc1F |
| InChI | InChI=1S/C8H9FN2O3/c9-5-4-11(6-2-1-3-14-6)8(13)10-7(5)12/h4,6H,1-3H2,(H,10,12,13) |
| InChIKey | WFWLQNSHRPWKFK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |