About 5-chloro-2-(2,4-dichlorophenoxy)phenol
5-chloro-2-(2,4-dichlorophenoxy)phenol (PubChem CID 5564) has the molecular formula C12H7Cl3O2
and a molecular weight of 289.55 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dichlorophenoxy)phenol.
Molecular Properties
| Compound Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| PubChem CID | 5564 |
| Molecular Formula | C12H7Cl3O2 |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| SMILES | Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H |
| InChIKey | XEFQLINVKFYRCS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2-(2,4-dichlorophenoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,4-dichlorophenoxy)phenol?
The IUPAC name of 5-chloro-2-(2,4-dichlorophenoxy)phenol (CID 5564) is 5-chloro-2-(2,4-dichlorophenoxy)phenol.
What is the SMILES notation for 5-chloro-2-(2,4-dichlorophenoxy)phenol?
The canonical SMILES for 5-chloro-2-(2,4-dichlorophenoxy)phenol is Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl.
What is the InChIKey of 5-chloro-2-(2,4-dichlorophenoxy)phenol?
The InChIKey is XEFQLINVKFYRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H.
What are the key properties of 5-chloro-2-(2,4-dichlorophenoxy)phenol?
5-chloro-2-(2,4-dichlorophenoxy)phenol has a molecular weight of 289.55 g/mol, XLogP of 5.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,4-dichlorophenoxy)phenol is sourced from PubChem (CID 5564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).