C18H19F3N2S — CID 5568
View drug profile → triflupromazineN,N-dimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine (PubChem CID 5568) has the molecular formula C18H19F3N2S and a molecular weight of 352.43 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine |
|---|---|
| PubChem CID | 5568 |
| Molecular Formula | C18H19F3N2S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N,N-dimethyl-3-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine |
| SMILES | CN(C)CCCN1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H19F3N2S/c1-22(2)10-5-11-23-14-6-3-4-7-16(14)24-17-9-8-13(12-15(17)23)18(19,20)21/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | XSCGXQMFQXDFCW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |