C13H14N2O — CID 3655
View drug profile → velnacrine9-amino-1,2,3,4-tetrahydroacridin-1-ol (PubChem CID 3655) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 9-amino-1,2,3,4-tetrahydroacridin-1-ol.
| Compound Name | 9-amino-1,2,3,4-tetrahydroacridin-1-ol |
|---|---|
| PubChem CID | 3655 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 9-amino-1,2,3,4-tetrahydroacridin-1-ol |
| SMILES | Nc1c2c(nc3ccccc13)CCCC2O |
| InChI | InChI=1S/C13H14N2O/c14-13-8-4-1-2-5-9(8)15-10-6-3-7-11(16)12(10)13/h1-2,4-5,11,16H,3,6-7H2,(H2,14,15) |
| InChIKey | HLVVITIHAZBPKB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |