C22H15NO6 — CID 10000385
1,8-dihydroxy-10-[2-(4-nitrophenyl)acetyl]-10H-anthracen-9-one (PubChem CID 10000385) has the molecular formula C22H15NO6 and a molecular weight of 389.36 g/mol. Its IUPAC name is 1,8-dihydroxy-10-[2-(4-nitrophenyl)acetyl]-10H-anthracen-9-one.
| Compound Name | 1,8-dihydroxy-10-[2-(4-nitrophenyl)acetyl]-10H-anthracen-9-one |
|---|---|
| PubChem CID | 10000385 |
| Molecular Formula | C22H15NO6 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 1,8-dihydroxy-10-[2-(4-nitrophenyl)acetyl]-10H-anthracen-9-one |
| SMILES | O=C1c2c(O)cccc2C(C(=O)Cc2ccc([N+](=O)[O-])cc2)c2cccc(O)c21 |
| InChI | InChI=1S/C22H15NO6/c24-16-5-1-3-14-19(15-4-2-6-17(25)21(15)22(27)20(14)16)18(26)11-12-7-9-13(10-8-12)23(28)29/h1-10,19,24-25H,11H2 |
| InChIKey | FTMIEKKGADRIGC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|