C22H23N3O2S — CID 10000669
(7aR)-1'-benzyl-6-phenylspiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,4'-piperidine]-5,7-dione (PubChem CID 10000669) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is (7aR)-1'-benzyl-6-phenylspiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,4'-piperidine]-5,7-dione.
| Compound Name | (7aR)-1'-benzyl-6-phenylspiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,4'-piperidine]-5,7-dione |
|---|---|
| PubChem CID | 10000669 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (7aR)-1'-benzyl-6-phenylspiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,4'-piperidine]-5,7-dione |
| SMILES | O=C1[C@@H]2CSC3(CCN(Cc4ccccc4)CC3)N2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C22H23N3O2S/c26-20-19-16-28-22(25(19)21(27)24(20)18-9-5-2-6-10-18)11-13-23(14-12-22)15-17-7-3-1-4-8-17/h1-10,19H,11-16H2/t19-/m0/s1 |
| InChIKey | OHTQHVFRQYHXNA-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|